About [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite
[2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (PubChem CID 126605844) has the molecular formula C12H14BrFN4O2S
and a molecular weight of 377.24 g/mol. Its IUPAC name is [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| PubChem CID | 126605844 |
| Molecular Formula | C12H14BrFN4O2S |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| SMILES | C[C@@H](NC(=O)c1cn(SF)c2ncc(Br)nc12)C(C)(C)O |
| InChI | InChI=1S/C12H14BrFN4O2S/c1-6(12(2,3)20)16-11(19)7-5-18(21-14)10-9(7)17-8(13)4-15-10/h4-6,20H,1-3H3,(H,16,19)/t6-/m1/s1 |
| InChIKey | GIICXFFLLCYVEA-ZCFIWIBFSA-N |
| XLogP | 2.46 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
The IUPAC name of [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (CID 126605844) is [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
What is the SMILES notation for [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
The canonical SMILES for [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite is C[C@@H](NC(=O)c1cn(SF)c2ncc(Br)nc12)C(C)(C)O.
What is the InChIKey of [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
The InChIKey is GIICXFFLLCYVEA-ZCFIWIBFSA-N. The full InChI is InChI=1S/C12H14BrFN4O2S/c1-6(12(2,3)20)16-11(19)7-5-18(21-14)10-9(7)17-8(13)4-15-10/h4-6,20H,1-3H3,(H,16,19)/t6-/m1/s1.
What are the key properties of [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
[2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite has a molecular weight of 377.24 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-7-[[(2R)-3-hydroxy-3-methylbutan-2-yl]carbamoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite is sourced from PubChem (CID 126605844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).