C16H14F2N6O2S — CID 126606043
[2-[4-fluoro-2-(methylamino)benzenecarboximidoyl]-7-(methoxycarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (PubChem CID 126606043) has the molecular formula C16H14F2N6O2S and a molecular weight of 392.39 g/mol. Its IUPAC name is [2-[4-fluoro-2-(methylamino)benzenecarboximidoyl]-7-(methoxycarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
| Compound Name | [2-[4-fluoro-2-(methylamino)benzenecarboximidoyl]-7-(methoxycarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
|---|---|
| PubChem CID | 126606043 |
| Molecular Formula | C16H14F2N6O2S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-[4-fluoro-2-(methylamino)benzenecarboximidoyl]-7-(methoxycarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| SMILES | [H]/N=C(\c1cnc2c(n1)c(C(=O)NOC)cn2SF)c1ccc(F)cc1NC |
| InChI | InChI=1S/C16H14F2N6O2S/c1-20-11-5-8(17)3-4-9(11)13(19)12-6-21-15-14(22-12)10(7-24(15)27-18)16(25)23-26-2/h3-7,19-20H,1-2H3,(H,23,25)/b19-13- |
| InChIKey | NQDZGMVTLXHLHF-UYRXBGFRSA-N |
| XLogP | 2.70 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|