C21H24N6O — CID 126606067
2-(2-amino-4-methylbenzenecarboximidoyl)-N-(2-cyclopropylpropan-2-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 126606067) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(2-amino-4-methylbenzenecarboximidoyl)-N-(2-cyclopropylpropan-2-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(2-amino-4-methylbenzenecarboximidoyl)-N-(2-cyclopropylpropan-2-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 126606067 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-(2-amino-4-methylbenzenecarboximidoyl)-N-(2-cyclopropylpropan-2-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | [H]/N=C(\c1cnc2[nH]cc(C(=O)NC(C)(C)C3CC3)c2n1)c1ccc(C)cc1N |
| InChI | InChI=1S/C21H24N6O/c1-11-4-7-13(15(22)8-11)17(23)16-10-25-19-18(26-16)14(9-24-19)20(28)27-21(2,3)12-5-6-12/h4,7-10,12,23H,5-6,22H2,1-3H3,(H,24,25)(H,27,28)/b23-17- |
| InChIKey | LKLRLEXVQJPCHN-QJOMJCCJSA-N |
| XLogP | 3.18 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|