C22H34N2 — CID 126606230
1-N-cyclohexa-1,3-dien-1-yl-1-N',2-dimethyl-1-N'-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)propane-1,1-diamine (PubChem CID 126606230) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-N-cyclohexa-1,3-dien-1-yl-1-N',2-dimethyl-1-N'-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)propane-1,1-diamine.
| Compound Name | 1-N-cyclohexa-1,3-dien-1-yl-1-N',2-dimethyl-1-N'-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)propane-1,1-diamine |
|---|---|
| PubChem CID | 126606230 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 1-N-cyclohexa-1,3-dien-1-yl-1-N',2-dimethyl-1-N'-(6-pent-2-enylcyclohexa-1,3-dien-1-yl)propane-1,1-diamine |
| SMILES | CCC=CCC1CC=CC=C1N(C)C(NC1=CC=CCC1)C(C)C |
| InChI | InChI=1S/C22H34N2/c1-5-6-8-13-19-14-11-12-17-21(19)24(4)22(18(2)3)23-20-15-9-7-10-16-20/h6-9,11-12,15,17-19,22-23H,5,10,13-14,16H2,1-4H3 |
| InChIKey | FTALJVBXLZUDTB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|