C8H9F4NO2 — CID 126606332
1-butan-2-yl-3,3,4,4-tetrafluoropyrrolidine-2,5-dione (PubChem CID 126606332) has the molecular formula C8H9F4NO2 and a molecular weight of 227.16 g/mol. Its IUPAC name is 1-butan-2-yl-3,3,4,4-tetrafluoropyrrolidine-2,5-dione.
| Compound Name | 1-butan-2-yl-3,3,4,4-tetrafluoropyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 126606332 |
| Molecular Formula | C8H9F4NO2 |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 1-butan-2-yl-3,3,4,4-tetrafluoropyrrolidine-2,5-dione |
| SMILES | CCC(C)N1C(=O)C(F)(F)C(F)(F)C1=O |
| InChI | InChI=1S/C8H9F4NO2/c1-3-4(2)13-5(14)7(9,10)8(11,12)6(13)15/h4H,3H2,1-2H3 |
| InChIKey | CEPHVWGQWONBSR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|