C18H30O6 — CID 12660650
(4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(prop-2-enoxy)ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 12660650) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is (4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(prop-2-enoxy)ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(prop-2-enoxy)ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 12660650 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (4R)-4-[(1R,2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-bis(prop-2-enoxy)ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCO[C@@H]([C@H](OCC=C)[C@H]1COC(C)(C)O1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H30O6/c1-7-9-19-15(13-11-21-17(3,4)23-13)16(20-10-8-2)14-12-22-18(5,6)24-14/h7-8,13-16H,1-2,9-12H2,3-6H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | XFVFLBJRKKLVSH-KLHDSHLOSA-N |
| XLogP | 2.43 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|