About (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol
(3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol (PubChem CID 126606523) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol.
Molecular Properties
| Compound Name | (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol |
| PubChem CID | 126606523 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol |
| SMILES | OCCNCC1OCCC(O)[C@@H]1O |
| InChI | InChI=1S/C8H17NO4/c10-3-2-9-5-7-8(12)6(11)1-4-13-7/h6-12H,1-5H2/t6?,7?,8-/m0/s1 |
| InChIKey | WPCXPFIQKXUBJQ-RRQHEKLDSA-N |
| XLogP | -1.92 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol?
The IUPAC name of (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol (CID 126606523) is (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol.
What is the SMILES notation for (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol?
The canonical SMILES for (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol is OCCNCC1OCCC(O)[C@@H]1O.
What is the InChIKey of (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol?
The InChIKey is WPCXPFIQKXUBJQ-RRQHEKLDSA-N. The full InChI is InChI=1S/C8H17NO4/c10-3-2-9-5-7-8(12)6(11)1-4-13-7/h6-12H,1-5H2/t6?,7?,8-/m0/s1.
What are the key properties of (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol?
(3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol has a molecular weight of 191.23 g/mol, XLogP of -1.92, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-[(2-hydroxyethylamino)methyl]oxane-3,4-diol is sourced from PubChem (CID 126606523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).