C11H20ClN3O3S — CID 126606561
(3aR,5R,6S,7R,7aR)-2-[chloro(ethyl)amino]-5-(ethylaminomethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 126606561) has the molecular formula C11H20ClN3O3S and a molecular weight of 309.82 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-[chloro(ethyl)amino]-5-(ethylaminomethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-[chloro(ethyl)amino]-5-(ethylaminomethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 126606561 |
| Molecular Formula | C11H20ClN3O3S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-[chloro(ethyl)amino]-5-(ethylaminomethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CCNC[C@H]1O[C@@H]2SC(N(Cl)CC)=N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20ClN3O3S/c1-3-13-5-6-8(16)9(17)7-10(18-6)19-11(14-7)15(12)4-2/h6-10,13,16-17H,3-5H2,1-2H3/t6-,7-,8-,9-,10-/m1/s1 |
| InChIKey | XRBCEZWYASHREB-VVULQXIFSA-N |
| XLogP | -0.01 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|