About [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine
[(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine (PubChem CID 126606599) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine.
Molecular Properties
| Compound Name | [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine |
| PubChem CID | 126606599 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine |
| SMILES | CC(C)OC(N)[C@@]1(C)C=C2CCC[C@H](C2)C1 |
| InChI | InChI=1S/C14H25NO/c1-10(2)16-13(15)14(3)8-11-5-4-6-12(7-11)9-14/h8,10,12-13H,4-7,9,15H2,1-3H3/t12-,13?,14+/m1/s1 |
| InChIKey | KARGAFVZZAHMAR-YIOYIWSBSA-N |
| XLogP | 3.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine?
The IUPAC name of [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine (CID 126606599) is [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine.
What is the SMILES notation for [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine?
The canonical SMILES for [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine is CC(C)OC(N)[C@@]1(C)C=C2CCC[C@H](C2)C1.
What is the InChIKey of [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine?
The InChIKey is KARGAFVZZAHMAR-YIOYIWSBSA-N. The full InChI is InChI=1S/C14H25NO/c1-10(2)16-13(15)14(3)8-11-5-4-6-12(7-11)9-14/h8,10,12-13H,4-7,9,15H2,1-3H3/t12-,13?,14+/m1/s1.
What are the key properties of [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine?
[(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine has a molecular weight of 223.36 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-3-methyl-3-bicyclo[3.3.1]non-1-enyl]-propan-2-yloxymethanamine is sourced from PubChem (CID 126606599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).