About (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol
(2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol (PubChem CID 126606756) has the molecular formula C18H24O5
and a molecular weight of 320.39 g/mol. Its IUPAC name is (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol |
| PubChem CID | 126606756 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol |
| SMILES | C=C(/C=C(\C=C(/C)OC)C(O)c1cc(OC)cc(OC)c1)OC |
| InChI | InChI=1S/C18H24O5/c1-12(20-3)7-14(8-13(2)21-4)18(19)15-9-16(22-5)11-17(10-15)23-6/h7-11,18-19H,1H2,2-6H3/b13-8+,14-7+ |
| InChIKey | AGOOSJBSGDBWGM-CCLLZULESA-N |
| XLogP | 3.37 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol?
The IUPAC name of (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol (CID 126606756) is (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol.
What is the SMILES notation for (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol?
The canonical SMILES for (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol is C=C(/C=C(\C=C(/C)OC)C(O)c1cc(OC)cc(OC)c1)OC.
What is the InChIKey of (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol?
The InChIKey is AGOOSJBSGDBWGM-CCLLZULESA-N. The full InChI is InChI=1S/C18H24O5/c1-12(20-3)7-14(8-13(2)21-4)18(19)15-9-16(22-5)11-17(10-15)23-6/h7-11,18-19H,1H2,2-6H3/b13-8+,14-7+.
What are the key properties of (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol?
(2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol has a molecular weight of 320.39 g/mol, XLogP of 3.37, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-(3,5-dimethoxyphenyl)-4-methoxy-2-[(E)-2-methoxyprop-1-enyl]penta-2,4-dien-1-ol is sourced from PubChem (CID 126606756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).