C19H24INO6 — CID 126606770
[2,4-dimethoxy-3-(methylamino)phenyl]-iodo-(2,3,4-trimethoxyphenyl)methanol (PubChem CID 126606770) has the molecular formula C19H24INO6 and a molecular weight of 489.31 g/mol. Its IUPAC name is [2,4-dimethoxy-3-(methylamino)phenyl]-iodo-(2,3,4-trimethoxyphenyl)methanol.
| Compound Name | [2,4-dimethoxy-3-(methylamino)phenyl]-iodo-(2,3,4-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 126606770 |
| Molecular Formula | C19H24INO6 |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | [2,4-dimethoxy-3-(methylamino)phenyl]-iodo-(2,3,4-trimethoxyphenyl)methanol |
| SMILES | CNc1c(OC)ccc(C(O)(I)c2ccc(OC)c(OC)c2OC)c1OC |
| InChI | InChI=1S/C19H24INO6/c1-21-15-13(23-2)9-7-11(16(15)25-4)19(20,22)12-8-10-14(24-3)18(27-6)17(12)26-5/h7-10,21-22H,1-6H3 |
| InChIKey | DWKWDIKYQVWFDN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|