C19H24O2 — CID 126606796
(2Z,6Z,8Z)-2-ethenyl-5,10-dimethyl-3-[(E)-2-methylbut-1-enyl]cyclodeca-2,6,8-triene-1,4-dione (PubChem CID 126606796) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2Z,6Z,8Z)-2-ethenyl-5,10-dimethyl-3-[(E)-2-methylbut-1-enyl]cyclodeca-2,6,8-triene-1,4-dione.
| Compound Name | (2Z,6Z,8Z)-2-ethenyl-5,10-dimethyl-3-[(E)-2-methylbut-1-enyl]cyclodeca-2,6,8-triene-1,4-dione |
|---|---|
| PubChem CID | 126606796 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2Z,6Z,8Z)-2-ethenyl-5,10-dimethyl-3-[(E)-2-methylbut-1-enyl]cyclodeca-2,6,8-triene-1,4-dione |
| SMILES | C=C/C1=C(\C=C(/C)CC)C(=O)C(C)/C=C\C=C/C(C)C1=O |
| InChI | InChI=1S/C19H24O2/c1-6-13(3)12-17-16(7-2)18(20)14(4)10-8-9-11-15(5)19(17)21/h7-12,14-15H,2,6H2,1,3-5H3/b10-8-,11-9-,13-12+,17-16- |
| InChIKey | WPGRDDPEIYAVMQ-JTAZNWDISA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |