C28H34O2 — CID 126606889
2-(7,8-dihydro-6H-benzo[7]annulen-6-yl)-5,5-dimethyl-2-(2-methyl-2,3,7,8-tetrahydronaphthalen-1-yl)-1,3-dioxane (PubChem CID 126606889) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-(7,8-dihydro-6H-benzo[7]annulen-6-yl)-5,5-dimethyl-2-(2-methyl-2,3,7,8-tetrahydronaphthalen-1-yl)-1,3-dioxane.
| Compound Name | 2-(7,8-dihydro-6H-benzo[7]annulen-6-yl)-5,5-dimethyl-2-(2-methyl-2,3,7,8-tetrahydronaphthalen-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 126606889 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-(7,8-dihydro-6H-benzo[7]annulen-6-yl)-5,5-dimethyl-2-(2-methyl-2,3,7,8-tetrahydronaphthalen-1-yl)-1,3-dioxane |
| SMILES | CC1CC=C2C=CCCC2=C1C1(C2C=c3ccccc3=CCC2)OCC(C)(C)CO1 |
| InChI | InChI=1S/C28H34O2/c1-20-15-16-22-10-6-7-14-25(22)26(20)28(29-18-27(2,3)19-30-28)24-13-8-12-21-9-4-5-11-23(21)17-24/h4-6,9-12,16-17,20,24H,7-8,13-15,18-19H2,1-3H3 |
| InChIKey | RGCYDBJFEPMQKO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |