C16H20O4 — CID 126606920
[(1E,3E)-3-(trimethoxymethyl)hexa-1,3,5-trienoxy]benzene (PubChem CID 126606920) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(1E,3E)-3-(trimethoxymethyl)hexa-1,3,5-trienoxy]benzene.
| Compound Name | [(1E,3E)-3-(trimethoxymethyl)hexa-1,3,5-trienoxy]benzene |
|---|---|
| PubChem CID | 126606920 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [(1E,3E)-3-(trimethoxymethyl)hexa-1,3,5-trienoxy]benzene |
| SMILES | C=C/C=C(\C=C\Oc1ccccc1)C(OC)(OC)OC |
| InChI | InChI=1S/C16H20O4/c1-5-9-14(16(17-2,18-3)19-4)12-13-20-15-10-7-6-8-11-15/h5-13H,1H2,2-4H3/b13-12+,14-9+ |
| InChIKey | HEKLJKLAYVYCSR-WIVVVKQNSA-N |
| XLogP | 3.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|