About N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide
N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide (PubChem CID 126607224) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide |
| PubChem CID | 126607224 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide |
| SMILES | COC1C=c2c(CCNC(C)=O)cccc2=CC1 |
| InChI | InChI=1S/C15H19NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-6,10,14H,7-9H2,1-2H3,(H,16,17) |
| InChIKey | MSLPJDYCDZJBAD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide?
The IUPAC name of N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide (CID 126607224) is N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide is COC1C=c2c(CCNC(C)=O)cccc2=CC1.
What is the InChIKey of N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide?
The InChIKey is MSLPJDYCDZJBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-6,10,14H,7-9H2,1-2H3,(H,16,17).
What are the key properties of N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide?
N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide has a molecular weight of 245.32 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(7-methoxy-6,7-dihydronaphthalen-1-yl)ethyl]acetamide is sourced from PubChem (CID 126607224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).