About 1-but-2-ynylsulfanyl-N,N-dimethylethenamine
1-but-2-ynylsulfanyl-N,N-dimethylethenamine (PubChem CID 126607413) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 1-but-2-ynylsulfanyl-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-but-2-ynylsulfanyl-N,N-dimethylethenamine |
| PubChem CID | 126607413 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 1-but-2-ynylsulfanyl-N,N-dimethylethenamine |
| SMILES | C=C(SCC#CC)N(C)C |
| InChI | InChI=1S/C8H13NS/c1-5-6-7-10-8(2)9(3)4/h2,7H2,1,3-4H3 |
| InChIKey | DLQPJXQCQBERJC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-ynylsulfanyl-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-ynylsulfanyl-N,N-dimethylethenamine?
The IUPAC name of 1-but-2-ynylsulfanyl-N,N-dimethylethenamine (CID 126607413) is 1-but-2-ynylsulfanyl-N,N-dimethylethenamine.
What is the SMILES notation for 1-but-2-ynylsulfanyl-N,N-dimethylethenamine?
The canonical SMILES for 1-but-2-ynylsulfanyl-N,N-dimethylethenamine is C=C(SCC#CC)N(C)C.
What is the InChIKey of 1-but-2-ynylsulfanyl-N,N-dimethylethenamine?
The InChIKey is DLQPJXQCQBERJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-5-6-7-10-8(2)9(3)4/h2,7H2,1,3-4H3.
What are the key properties of 1-but-2-ynylsulfanyl-N,N-dimethylethenamine?
1-but-2-ynylsulfanyl-N,N-dimethylethenamine has a molecular weight of 155.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-ynylsulfanyl-N,N-dimethylethenamine is sourced from PubChem (CID 126607413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).