C18H24O2 — CID 126607890
(2Z,6Z,9Z)-3-[(E)-3-methylbut-1-enyl]-2-[(Z)-prop-1-enyl]-1-oxacycloundeca-2,6,9-trien-4-one (PubChem CID 126607890) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2Z,6Z,9Z)-3-[(E)-3-methylbut-1-enyl]-2-[(Z)-prop-1-enyl]-1-oxacycloundeca-2,6,9-trien-4-one.
| Compound Name | (2Z,6Z,9Z)-3-[(E)-3-methylbut-1-enyl]-2-[(Z)-prop-1-enyl]-1-oxacycloundeca-2,6,9-trien-4-one |
|---|---|
| PubChem CID | 126607890 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2Z,6Z,9Z)-3-[(E)-3-methylbut-1-enyl]-2-[(Z)-prop-1-enyl]-1-oxacycloundeca-2,6,9-trien-4-one |
| SMILES | C/C=C\C1=C(/C=C/C(C)C)C(=O)C/C=C\C/C=C\CO1 |
| InChI | InChI=1S/C18H24O2/c1-4-10-18-16(13-12-15(2)3)17(19)11-8-6-5-7-9-14-20-18/h4,6-10,12-13,15H,5,11,14H2,1-3H3/b8-6-,9-7-,10-4-,13-12+,18-16- |
| InChIKey | ZUSNBMGSXJJTPC-MFAWKWRZSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|