About 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene
1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene (PubChem CID 126607959) has the molecular formula C20H24Br2
and a molecular weight of 424.22 g/mol. Its IUPAC name is 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene.
Molecular Properties
| Compound Name | 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene |
| PubChem CID | 126607959 |
| Molecular Formula | C20H24Br2 |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene |
| SMILES | CC(C)(C)c1cc(-c2cc(Br)cc(Br)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24Br2/c1-19(2,3)15-7-13(8-16(11-15)20(4,5)6)14-9-17(21)12-18(22)10-14/h7-12H,1-6H3 |
| InChIKey | ASOYQEMUPILFJS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene?
The IUPAC name of 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene (CID 126607959) is 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene.
What is the SMILES notation for 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene?
The canonical SMILES for 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene is CC(C)(C)c1cc(-c2cc(Br)cc(Br)c2)cc(C(C)(C)C)c1.
What is the InChIKey of 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene?
The InChIKey is ASOYQEMUPILFJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24Br2/c1-19(2,3)15-7-13(8-16(11-15)20(4,5)6)14-9-17(21)12-18(22)10-14/h7-12H,1-6H3.
What are the key properties of 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene?
1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene has a molecular weight of 424.22 g/mol, XLogP of 7.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5-(3,5-ditert-butylphenyl)benzene is sourced from PubChem (CID 126607959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).