C7H11BrF6N2O4S2 — CID 126608059
N-[3-(bromoamino)pentan-3-yl]-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 126608059) has the molecular formula C7H11BrF6N2O4S2 and a molecular weight of 445.20 g/mol. Its IUPAC name is N-[3-(bromoamino)pentan-3-yl]-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | N-[3-(bromoamino)pentan-3-yl]-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 126608059 |
| Molecular Formula | C7H11BrF6N2O4S2 |
| Molecular Weight | 445.20 g/mol |
| Exact Mass | 443.92 |
| IUPAC Name | N-[3-(bromoamino)pentan-3-yl]-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCC(CC)(NBr)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11BrF6N2O4S2/c1-3-5(4-2,15-8)16(21(17,18)6(9,10)11)22(19,20)7(12,13)14/h15H,3-4H2,1-2H3 |
| InChIKey | HWFNNOXJESPZHN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|