C10H14N2 — CID 126608140
2-methanimidoyl-5,5-dimethylcyclohepta-1,3,6-trien-1-amine (PubChem CID 126608140) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-methanimidoyl-5,5-dimethylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | 2-methanimidoyl-5,5-dimethylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 126608140 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-methanimidoyl-5,5-dimethylcyclohepta-1,3,6-trien-1-amine |
| SMILES | [H]/N=C/C1=C(N)C=CC(C)(C)C=C1 |
| InChI | InChI=1S/C10H14N2/c1-10(2)5-3-8(7-11)9(12)4-6-10/h3-7,11H,12H2,1-2H3/b11-7+ |
| InChIKey | WMWWWNOICGOXHS-YRNVUSSQSA-N |
| XLogP | 2.00 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|