C11H11N3OS — CID 126608204
3-amino-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carbaldehyde (PubChem CID 126608204) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 3-amino-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carbaldehyde.
| Compound Name | 3-amino-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 126608204 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 3-amino-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carbaldehyde |
| SMILES | Nc1c(C=O)sc2nc3c(cc12)CNCC3 |
| InChI | InChI=1S/C11H11N3OS/c12-10-7-3-6-4-13-2-1-8(6)14-11(7)16-9(10)5-15/h3,5,13H,1-2,4,12H2 |
| InChIKey | VTUVPXZAWBOJJI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|