C17H38N8O — CID 126608456
1-(1,8-diamino-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-3-yl)propan-2-one (PubChem CID 126608456) has the molecular formula C17H38N8O and a molecular weight of 370.55 g/mol. Its IUPAC name is 1-(1,8-diamino-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-3-yl)propan-2-one.
| Compound Name | 1-(1,8-diamino-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-3-yl)propan-2-one |
|---|---|
| PubChem CID | 126608456 |
| Molecular Formula | C17H38N8O |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 1-(1,8-diamino-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-3-yl)propan-2-one |
| SMILES | CC(=O)CN1CCNCC2(N)CNCCNCC(N)(CNCCNC2)C1 |
| InChI | InChI=1S/C17H38N8O/c1-15(26)8-25-7-6-24-11-16(18)9-20-2-4-22-12-17(19,14-25)13-23-5-3-21-10-16/h20-24H,2-14,18-19H2,1H3 |
| InChIKey | VUNMNUDGOQSGRE-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |