About 3-tert-butyl-4-fluoro-1,5-dimethylindazole
3-tert-butyl-4-fluoro-1,5-dimethylindazole (PubChem CID 126608557) has the molecular formula C13H17FN2
and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-tert-butyl-4-fluoro-1,5-dimethylindazole.
Molecular Properties
| Compound Name | 3-tert-butyl-4-fluoro-1,5-dimethylindazole |
| PubChem CID | 126608557 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-tert-butyl-4-fluoro-1,5-dimethylindazole |
| SMILES | Cc1ccc2c(c(C(C)(C)C)nn2C)c1F |
| InChI | InChI=1S/C13H17FN2/c1-8-6-7-9-10(11(8)14)12(13(2,3)4)15-16(9)5/h6-7H,1-5H3 |
| InChIKey | PRCQVNFCMPPAQX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-4-fluoro-1,5-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-fluoro-1,5-dimethylindazole?
The IUPAC name of 3-tert-butyl-4-fluoro-1,5-dimethylindazole (CID 126608557) is 3-tert-butyl-4-fluoro-1,5-dimethylindazole.
What is the SMILES notation for 3-tert-butyl-4-fluoro-1,5-dimethylindazole?
The canonical SMILES for 3-tert-butyl-4-fluoro-1,5-dimethylindazole is Cc1ccc2c(c(C(C)(C)C)nn2C)c1F.
What is the InChIKey of 3-tert-butyl-4-fluoro-1,5-dimethylindazole?
The InChIKey is PRCQVNFCMPPAQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2/c1-8-6-7-9-10(11(8)14)12(13(2,3)4)15-16(9)5/h6-7H,1-5H3.
What are the key properties of 3-tert-butyl-4-fluoro-1,5-dimethylindazole?
3-tert-butyl-4-fluoro-1,5-dimethylindazole has a molecular weight of 220.29 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-fluoro-1,5-dimethylindazole is sourced from PubChem (CID 126608557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).