C44H24Cl2F6N6 — CID 126608675
2-[3,5-dichloro-4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(trifluoromethyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 126608675) has the molecular formula C44H24Cl2F6N6 and a molecular weight of 821.61 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(trifluoromethyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3,5-dichloro-4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(trifluoromethyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 126608675 |
| Molecular Formula | C44H24Cl2F6N6 |
| Molecular Weight | 821.61 g/mol |
| Exact Mass | 820.13 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(trifluoromethyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC(F)(F)c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(C(F)(F)F)c1-c1c(Cl)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1Cl |
| InChI | InChI=1S/C44H24Cl2F6N6/c45-33-23-30(42-57-39(27-17-9-3-10-18-27)54-40(58-42)28-19-11-4-12-20-28)24-34(46)36(33)35-31(43(47,48)49)21-29(22-32(35)44(50,51)52)41-55-37(25-13-5-1-6-14-25)53-38(56-41)26-15-7-2-8-16-26/h1-24H |
| InChIKey | DLPCGCLVMTVSMO-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.61 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |