C46H22F14N6 — CID 126608678
2-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazine (PubChem CID 126608678) has the molecular formula C46H22F14N6 and a molecular weight of 924.70 g/mol. Its IUPAC name is 2-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 126608678 |
| Molecular Formula | C46H22F14N6 |
| Molecular Weight | 924.70 g/mol |
| Exact Mass | 924.17 |
| IUPAC Name | 2-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3c(F)c(F)c(-c4c(F)c(F)c(-c5nc(-c6ccc(C(F)(F)F)cc6)nc(-c6ccc(C(F)(F)F)cc6)n5)c(F)c4F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C46H22F14N6/c1-19-3-7-21(8-4-19)39-61-40(22-9-5-20(2)6-10-22)64-43(63-39)29-35(51)31(47)27(32(48)36(29)52)28-33(49)37(53)30(38(54)34(28)50)44-65-41(23-11-15-25(16-12-23)45(55,56)57)62-42(66-44)24-13-17-26(18-14-24)46(58,59)60/h3-18H,1-2H3 |
| InChIKey | ZVWDZXSHYLWNBZ-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.70 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|