About 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one
1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one (PubChem CID 126608823) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one.
Molecular Properties
| Compound Name | 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one |
| PubChem CID | 126608823 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one |
| SMILES | Cc1cc(C(C)C)c2n(c1=O)CCC2(C)F |
| InChI | InChI=1S/C13H18FNO/c1-8(2)10-7-9(3)12(16)15-6-5-13(4,14)11(10)15/h7-8H,5-6H2,1-4H3 |
| InChIKey | WSBKHIILTNELJX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one?
The IUPAC name of 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one (CID 126608823) is 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one.
What is the SMILES notation for 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one?
The canonical SMILES for 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one is Cc1cc(C(C)C)c2n(c1=O)CCC2(C)F.
What is the InChIKey of 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one?
The InChIKey is WSBKHIILTNELJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO/c1-8(2)10-7-9(3)12(16)15-6-5-13(4,14)11(10)15/h7-8H,5-6H2,1-4H3.
What are the key properties of 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one?
1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one has a molecular weight of 223.29 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-1,6-dimethyl-8-propan-2-yl-2,3-dihydroindolizin-5-one is sourced from PubChem (CID 126608823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).