C12H21N2+ — CID 126609116
2-[3-(2,2-dimethylpropyl)pyridin-1-ium-1-yl]ethanamine (PubChem CID 126609116) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropyl)pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[3-(2,2-dimethylpropyl)pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 126609116 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | 2-[3-(2,2-dimethylpropyl)pyridin-1-ium-1-yl]ethanamine |
| SMILES | CC(C)(C)Cc1ccc[n+](CCN)c1 |
| InChI | InChI=1S/C12H21N2/c1-12(2,3)9-11-5-4-7-14(10-11)8-6-13/h4-5,7,10H,6,8-9,13H2,1-3H3/q+1 |
| InChIKey | LSLGIWKKHDTZGJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|