C16H19FN6O — CID 126609242
6-(2-fluoropropan-2-yl)-2-N-(4,5,7-trimethyl-1,3-benzoxazol-6-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 126609242) has the molecular formula C16H19FN6O and a molecular weight of 330.37 g/mol. Its IUPAC name is 6-(2-fluoropropan-2-yl)-2-N-(4,5,7-trimethyl-1,3-benzoxazol-6-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-fluoropropan-2-yl)-2-N-(4,5,7-trimethyl-1,3-benzoxazol-6-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 126609242 |
| Molecular Formula | C16H19FN6O |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-(2-fluoropropan-2-yl)-2-N-(4,5,7-trimethyl-1,3-benzoxazol-6-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1c(Nc2nc(N)nc(C(C)(C)F)n2)c(C)c2ocnc2c1C |
| InChI | InChI=1S/C16H19FN6O/c1-7-8(2)11-12(24-6-19-11)9(3)10(7)20-15-22-13(16(4,5)17)21-14(18)23-15/h6H,1-5H3,(H3,18,20,21,22,23) |
| InChIKey | LYECAZMPZXUYAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |