C28H26N2O2 — CID 126609611
[(E)-[1-[1-(3-methylcyclohepta-1,2,4,6-tetraen-1-yl)indol-3-yl]-2-(2-methylphenyl)ethylidene]amino] propanoate (PubChem CID 126609611) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is [(E)-[1-[1-(3-methylcyclohepta-1,2,4,6-tetraen-1-yl)indol-3-yl]-2-(2-methylphenyl)ethylidene]amino] propanoate.
| Compound Name | [(E)-[1-[1-(3-methylcyclohepta-1,2,4,6-tetraen-1-yl)indol-3-yl]-2-(2-methylphenyl)ethylidene]amino] propanoate |
|---|---|
| PubChem CID | 126609611 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [(E)-[1-[1-(3-methylcyclohepta-1,2,4,6-tetraen-1-yl)indol-3-yl]-2-(2-methylphenyl)ethylidene]amino] propanoate |
| SMILES | CCC(=O)O/N=C(\Cc1ccccc1C)c1cn(C2=C=C(C)C=CC=C2)c2ccccc12 |
| InChI | InChI=1S/C28H26N2O2/c1-4-28(31)32-29-26(18-22-13-7-6-12-21(22)3)25-19-30(27-16-10-9-15-24(25)27)23-14-8-5-11-20(2)17-23/h5-16,19H,4,18H2,1-3H3/b29-26+ |
| InChIKey | FYDWHKHGZPITGQ-PBBVDAKRSA-N |
| XLogP | 6.36 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|