C15H11F3N4O2S — CID 126610023
3-[[5-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]prop-1-en-2-ol (PubChem CID 126610023) has the molecular formula C15H11F3N4O2S and a molecular weight of 368.34 g/mol. Its IUPAC name is 3-[[5-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]prop-1-en-2-ol.
| Compound Name | 3-[[5-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 126610023 |
| Molecular Formula | C15H11F3N4O2S |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 3-[[5-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]prop-1-en-2-ol |
| SMILES | C=C(O)CSc1n[nH]c(-c2ccc(-c3ccc(C(F)(F)F)nc3)o2)n1 |
| InChI | InChI=1S/C15H11F3N4O2S/c1-8(23)7-25-14-20-13(21-22-14)11-4-3-10(24-11)9-2-5-12(19-6-9)15(16,17)18/h2-6,23H,1,7H2,(H,20,21,22) |
| InChIKey | NXOCLDJAKFDXLU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|