C21H19N5O3S — CID 126610561
1-[[5-[4-methyl-3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one (PubChem CID 126610561) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-[[5-[4-methyl-3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one.
| Compound Name | 1-[[5-[4-methyl-3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one |
|---|---|
| PubChem CID | 126610561 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[[5-[4-methyl-3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one |
| SMILES | CC(=O)CSc1n[nH]c(-c2cc(-c3ccc4c(ccn4C)c3)c(C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H19N5O3S/c1-12(27)11-30-21-22-20(23-24-21)16-9-17(13(2)19(10-16)26(28)29)14-4-5-18-15(8-14)6-7-25(18)3/h4-10H,11H2,1-3H3,(H,22,23,24) |
| InChIKey | CORKHMIRMUQDAQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|