C14H26N2O3 — CID 126610677
N-[(1R,2R,6S)-6-amino-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 126610677) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[(1R,2R,6S)-6-amino-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-6-amino-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 126610677 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[(1R,2R,6S)-6-amino-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(CO)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H26N2O3/c1-4-11(5-2)19-13-7-10(8-17)6-12(15)14(13)16-9(3)18/h7,11-14,17H,4-6,8,15H2,1-3H3,(H,16,18)/t12-,13+,14+/m0/s1 |
| InChIKey | BMZRPBYNYKRSGF-BFHYXJOUSA-N |
| XLogP | 0.71 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|