C7H7F10N — CID 12661112
1,3,3,3-tetrafluoro-N,N-dimethyl-2,2-bis(trifluoromethyl)propan-1-amine (PubChem CID 12661112) has the molecular formula C7H7F10N and a molecular weight of 295.12 g/mol. Its IUPAC name is 1,3,3,3-tetrafluoro-N,N-dimethyl-2,2-bis(trifluoromethyl)propan-1-amine.
| Compound Name | 1,3,3,3-tetrafluoro-N,N-dimethyl-2,2-bis(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 12661112 |
| Molecular Formula | C7H7F10N |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1,3,3,3-tetrafluoro-N,N-dimethyl-2,2-bis(trifluoromethyl)propan-1-amine |
| SMILES | CN(C)C(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F10N/c1-18(2)3(8)4(5(9,10)11,6(12,13)14)7(15,16)17/h3H,1-2H3 |
| InChIKey | NDWXXRNYDZRUNQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|