About (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol
(3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol (PubChem CID 126611428) has the molecular formula C12H13FS
and a molecular weight of 208.30 g/mol. Its IUPAC name is (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol.
Molecular Properties
| Compound Name | (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol |
| PubChem CID | 126611428 |
| Molecular Formula | C12H13FS |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol |
| SMILES | C=C/C(=C(/S)CC)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FS/c1-3-11(12(14)4-2)9-5-7-10(13)8-6-9/h3,5-8,14H,1,4H2,2H3/b12-11- |
| InChIKey | OQDCZEJTOFQJDU-QXMHVHEDSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol?
The IUPAC name of (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol (CID 126611428) is (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol.
What is the SMILES notation for (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol?
The canonical SMILES for (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol is C=C/C(=C(/S)CC)c1ccc(F)cc1.
What is the InChIKey of (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol?
The InChIKey is OQDCZEJTOFQJDU-QXMHVHEDSA-N. The full InChI is InChI=1S/C12H13FS/c1-3-11(12(14)4-2)9-5-7-10(13)8-6-9/h3,5-8,14H,1,4H2,2H3/b12-11-.
What are the key properties of (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol?
(3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol has a molecular weight of 208.30 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-(4-fluorophenyl)hexa-3,5-diene-3-thiol is sourced from PubChem (CID 126611428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).