C22H24N2O5S — CID 126611466
methyl (3S)-4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-3-(5-ethyl-2-pyridinyl)butanoate (PubChem CID 126611466) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl (3S)-4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-3-(5-ethyl-2-pyridinyl)butanoate.
| Compound Name | methyl (3S)-4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-3-(5-ethyl-2-pyridinyl)butanoate |
|---|---|
| PubChem CID | 126611466 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl (3S)-4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-3-(5-ethyl-2-pyridinyl)butanoate |
| SMILES | CCc1ccc([C@@H](COc2ccc(CC3SC(=O)NC3=O)cc2)CC(=O)OC)nc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-14-6-9-18(23-12-14)16(11-20(25)28-2)13-29-17-7-4-15(5-8-17)10-19-21(26)24-22(27)30-19/h4-9,12,16,19H,3,10-11,13H2,1-2H3,(H,24,26,27)/t16-,19?/m1/s1 |
| InChIKey | QWPDMFLKUQSVEX-VTBWFHPJSA-N |
| XLogP | 3.26 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|