About bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane (PubChem CID 126611627) has the molecular formula C16H15F2N3S
and a molecular weight of 319.38 g/mol. Its IUPAC name is bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane.
Molecular Properties
| Compound Name | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane |
| PubChem CID | 126611627 |
| Molecular Formula | C16H15F2N3S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane |
| SMILES | CS(Cn1cncn1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15F2N3S/c1-22(12-21-11-19-10-20-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16/h2-11H,12H2,1H3 |
| InChIKey | ILLMCRFGVBOUHN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane?
The IUPAC name of bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane (CID 126611627) is bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane.
What is the SMILES notation for bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane?
The canonical SMILES for bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane is CS(Cn1cncn1)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane?
The InChIKey is ILLMCRFGVBOUHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2N3S/c1-22(12-21-11-19-10-20-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16/h2-11H,12H2,1H3.
What are the key properties of bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane?
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane has a molecular weight of 319.38 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)-λ4-sulfane is sourced from PubChem (CID 126611627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).