About 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one
8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one (PubChem CID 126611910) has the molecular formula C11H13F2NO
and a molecular weight of 213.23 g/mol. Its IUPAC name is 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one.
Molecular Properties
| Compound Name | 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one |
| PubChem CID | 126611910 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one |
| SMILES | CCc1cc(C)c(=O)n2c1C(F)(F)CC2 |
| InChI | InChI=1S/C11H13F2NO/c1-3-8-6-7(2)10(15)14-5-4-11(12,13)9(8)14/h6H,3-5H2,1-2H3 |
| InChIKey | VLGKGMPBOJTVLO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one?
The IUPAC name of 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one (CID 126611910) is 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one.
What is the SMILES notation for 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one?
The canonical SMILES for 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one is CCc1cc(C)c(=O)n2c1C(F)(F)CC2.
What is the InChIKey of 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one?
The InChIKey is VLGKGMPBOJTVLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO/c1-3-8-6-7(2)10(15)14-5-4-11(12,13)9(8)14/h6H,3-5H2,1-2H3.
What are the key properties of 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one?
8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one has a molecular weight of 213.23 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-1,1-difluoro-6-methyl-2,3-dihydroindolizin-5-one is sourced from PubChem (CID 126611910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).