C15H20ClF2N — CID 126611979
1-[(3E,5Z)-5-[(1R)-1-chloroethyl]octa-1,3,5,7-tetraen-4-yl]-4,4-difluoropiperidine (PubChem CID 126611979) has the molecular formula C15H20ClF2N and a molecular weight of 287.78 g/mol. Its IUPAC name is 1-[(3E,5Z)-5-[(1R)-1-chloroethyl]octa-1,3,5,7-tetraen-4-yl]-4,4-difluoropiperidine.
| Compound Name | 1-[(3E,5Z)-5-[(1R)-1-chloroethyl]octa-1,3,5,7-tetraen-4-yl]-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 126611979 |
| Molecular Formula | C15H20ClF2N |
| Molecular Weight | 287.78 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[(3E,5Z)-5-[(1R)-1-chloroethyl]octa-1,3,5,7-tetraen-4-yl]-4,4-difluoropiperidine |
| SMILES | C=C/C=C(C(=C\C=C)/N1CCC(F)(F)CC1)\[C@@H](C)Cl |
| InChI | InChI=1S/C15H20ClF2N/c1-4-6-13(12(3)16)14(7-5-2)19-10-8-15(17,18)9-11-19/h4-7,12H,1-2,8-11H2,3H3/b13-6+,14-7+/t12-/m1/s1 |
| InChIKey | NZCNHALLSMDFQL-HWRSVQFISA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|