About (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine
(1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine (PubChem CID 126612087) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine.
Molecular Properties
| Compound Name | (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine |
| PubChem CID | 126612087 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine |
| SMILES | C=C/C=C(/N)N(C)C(C)C |
| InChI | InChI=1S/C8H16N2/c1-5-6-8(9)10(4)7(2)3/h5-7H,1,9H2,2-4H3/b8-6- |
| InChIKey | HGBNGWKLEDGSDD-VURMDHGXSA-N |
| XLogP | 1.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine?
The IUPAC name of (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine (CID 126612087) is (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine.
What is the SMILES notation for (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine?
The canonical SMILES for (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine is C=C/C=C(/N)N(C)C(C)C.
What is the InChIKey of (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine?
The InChIKey is HGBNGWKLEDGSDD-VURMDHGXSA-N. The full InChI is InChI=1S/C8H16N2/c1-5-6-8(9)10(4)7(2)3/h5-7H,1,9H2,2-4H3/b8-6-.
What are the key properties of (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine?
(1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine has a molecular weight of 140.23 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-N'-methyl-1-N'-propan-2-ylbuta-1,3-diene-1,1-diamine is sourced from PubChem (CID 126612087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).