C14H25NO — CID 126612291
(9Z)-1-amino-2,5-dimethyldodeca-5,6,9-trien-1-ol (PubChem CID 126612291) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (9Z)-1-amino-2,5-dimethyldodeca-5,6,9-trien-1-ol.
| Compound Name | (9Z)-1-amino-2,5-dimethyldodeca-5,6,9-trien-1-ol |
|---|---|
| PubChem CID | 126612291 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (9Z)-1-amino-2,5-dimethyldodeca-5,6,9-trien-1-ol |
| SMILES | CC/C=C\CC=C=C(C)CCC(C)C(N)O |
| InChI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-12(2)10-11-13(3)14(15)16/h5-6,8,13-14,16H,4,7,10-11,15H2,1-3H3/b6-5- |
| InChIKey | LHVRDYFBBDOSIX-WAYWQWQTSA-N |
| XLogP | 3.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|