About 4-phenyl-2,3-dihydrothiophene 1,1-dioxide
4-phenyl-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 12661232) has the molecular formula C10H10O2S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 4-phenyl-2,3-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 4-phenyl-2,3-dihydrothiophene 1,1-dioxide |
| PubChem CID | 12661232 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4-phenyl-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C10H10O2S/c11-13(12)7-6-10(8-13)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | OYADUSJXUNXFQD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 4-phenyl-2,3-dihydrothiophene 1,1-dioxide (CID 12661232) is 4-phenyl-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 4-phenyl-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 4-phenyl-2,3-dihydrothiophene 1,1-dioxide is O=S1(=O)C=C(c2ccccc2)CC1.
What is the InChIKey of 4-phenyl-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is OYADUSJXUNXFQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S/c11-13(12)7-6-10(8-13)9-4-2-1-3-5-9/h1-5,8H,6-7H2.
What are the key properties of 4-phenyl-2,3-dihydrothiophene 1,1-dioxide?
4-phenyl-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 194.26 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 12661232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).