C12H19NO — CID 126612378
(6Z,8Z)-3-(methylamino)undeca-6,8,10-trien-2-one (PubChem CID 126612378) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (6Z,8Z)-3-(methylamino)undeca-6,8,10-trien-2-one.
| Compound Name | (6Z,8Z)-3-(methylamino)undeca-6,8,10-trien-2-one |
|---|---|
| PubChem CID | 126612378 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (6Z,8Z)-3-(methylamino)undeca-6,8,10-trien-2-one |
| SMILES | C=C/C=C\C=C/CCC(NC)C(C)=O |
| InChI | InChI=1S/C12H19NO/c1-4-5-6-7-8-9-10-12(13-3)11(2)14/h4-8,12-13H,1,9-10H2,2-3H3/b6-5-,8-7- |
| InChIKey | UTWKXXYCQLUUMG-ISTTXYCBSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|