C28H31NO3 — CID 126612465
(8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-16-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 126612465) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-16-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-16-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 126612465 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-16-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | [H]/N=C1\C=C2CC[C@@H]3C(=C2CC1)[C@@H](c1ccc2c(c1)OCO2)C[C@]1(C)[C@@H](O)C(C#CC)C[C@@H]31 |
| InChI | InChI=1S/C28H31NO3/c1-3-4-18-12-23-21-8-5-16-11-19(29)7-9-20(16)26(21)22(14-28(23,2)27(18)30)17-6-10-24-25(13-17)32-15-31-24/h6,10-11,13,18,21-23,27,29-30H,5,7-9,12,14-15H2,1-2H3/b29-19-/t18?,21-,22+,23-,27-,28-/m0/s1 |
| InChIKey | VQYZREDWXVQXCJ-NNPNYVDTSA-N |
| XLogP | 5.38 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|