C29H39F5N2O5S — CID 126612594
(2,3,4,5,6-pentafluorophenyl) 2-[1-methoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-(pentoxymethyl)amino]pentyl]-1,3-thiazole-4-carboxylate (PubChem CID 126612594) has the molecular formula C29H39F5N2O5S and a molecular weight of 622.70 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[1-methoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-(pentoxymethyl)amino]pentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[1-methoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-(pentoxymethyl)amino]pentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 126612594 |
| Molecular Formula | C29H39F5N2O5S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[1-methoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-(pentoxymethyl)amino]pentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCOCN(C(=O)C[C@@H](C)CC)C(CC(OC)c1nc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cs1)C(C)C |
| InChI | InChI=1S/C29H39F5N2O5S/c1-7-9-10-11-40-15-36(21(37)12-17(5)8-2)19(16(3)4)13-20(39-6)28-35-18(14-42-28)29(38)41-27-25(33)23(31)22(30)24(32)26(27)34/h14,16-17,19-20H,7-13,15H2,1-6H3/t17-,19?,20?/m0/s1 |
| InChIKey | NUMNKMGHVGLVRE-KKXNLOMOSA-N |
| XLogP | 7.59 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|