About 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione
6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione (PubChem CID 12661260) has the molecular formula C12H11NO5
and a molecular weight of 249.22 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione |
| PubChem CID | 12661260 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione |
| SMILES | COc1cc2c(cc1OC)C(=O)N(C)C(=O)C2=O |
| InChI | InChI=1S/C12H11NO5/c1-13-11(15)7-5-9(18-3)8(17-2)4-6(7)10(14)12(13)16/h4-5H,1-3H3 |
| InChIKey | AKOGVJUSAFGQRH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione?
The IUPAC name of 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione (CID 12661260) is 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione.
What is the SMILES notation for 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione?
The canonical SMILES for 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione is COc1cc2c(cc1OC)C(=O)N(C)C(=O)C2=O.
What is the InChIKey of 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione?
The InChIKey is AKOGVJUSAFGQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO5/c1-13-11(15)7-5-9(18-3)8(17-2)4-6(7)10(14)12(13)16/h4-5H,1-3H3.
What are the key properties of 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione?
6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione has a molecular weight of 249.22 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-methylisoquinoline-1,3,4-trione is sourced from PubChem (CID 12661260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).