C18H33NO — CID 126612692
(4E,8E)-5,9,13-trimethyl-1-(methylamino)tetradeca-4,8,12-trien-1-ol (PubChem CID 126612692) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is (4E,8E)-5,9,13-trimethyl-1-(methylamino)tetradeca-4,8,12-trien-1-ol.
| Compound Name | (4E,8E)-5,9,13-trimethyl-1-(methylamino)tetradeca-4,8,12-trien-1-ol |
|---|---|
| PubChem CID | 126612692 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | (4E,8E)-5,9,13-trimethyl-1-(methylamino)tetradeca-4,8,12-trien-1-ol |
| SMILES | CNC(O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H33NO/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(20)19-5/h9,11,13,18-20H,6-8,10,12,14H2,1-5H3/b16-11+,17-13+ |
| InChIKey | DPOQFNIXXTWESX-IUBLYSDUSA-N |
| XLogP | 4.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|