C23H27BrN2O4 — CID 126613100
1-[(3S,3aR,6S,6aS)-6-(6-bromonaphthalen-2-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea (PubChem CID 126613100) has the molecular formula C23H27BrN2O4 and a molecular weight of 475.38 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aS)-6-(6-bromonaphthalen-2-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3S,3aR,6S,6aS)-6-(6-bromonaphthalen-2-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 126613100 |
| Molecular Formula | C23H27BrN2O4 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1-[(3S,3aR,6S,6aS)-6-(6-bromonaphthalen-2-yl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2Oc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C23H27BrN2O4/c24-16-8-6-15-11-18(9-7-14(15)10-16)30-20-13-29-21-19(12-28-22(20)21)26-23(27)25-17-4-2-1-3-5-17/h6-11,17,19-22H,1-5,12-13H2,(H2,25,26,27)/t19-,20-,21+,22+/m0/s1 |
| InChIKey | UYZZDTWHZBGZQT-FNAHDJPLSA-N |
| XLogP | 4.15 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |