C17H18N2O3 — CID 126613361
5-[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]-3,4,6,7-tetrahydrofuro[3,4-c]pyridin-1-one (PubChem CID 126613361) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]-3,4,6,7-tetrahydrofuro[3,4-c]pyridin-1-one.
| Compound Name | 5-[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]-3,4,6,7-tetrahydrofuro[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 126613361 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]-3,4,6,7-tetrahydrofuro[3,4-c]pyridin-1-one |
| SMILES | O=C1OCC2=C1CCN(C(=O)[C@H]1Cc3ccccc3CN1)C2 |
| InChI | InChI=1S/C17H18N2O3/c20-16(15-7-11-3-1-2-4-12(11)8-18-15)19-6-5-14-13(9-19)10-22-17(14)21/h1-4,15,18H,5-10H2/t15-/m1/s1 |
| InChIKey | BZQAESMVIDWAKS-OAHLLOKOSA-N |
| XLogP | 0.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |