C24H26N2 — CID 126613562
N-(2,6-dimethylphenyl)-6-[2-(2,6-dimethylphenyl)iminoethyl]cyclohexa-2,4-dien-1-imine (PubChem CID 126613562) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-6-[2-(2,6-dimethylphenyl)iminoethyl]cyclohexa-2,4-dien-1-imine.
| Compound Name | N-(2,6-dimethylphenyl)-6-[2-(2,6-dimethylphenyl)iminoethyl]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 126613562 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-6-[2-(2,6-dimethylphenyl)iminoethyl]cyclohexa-2,4-dien-1-imine |
| SMILES | Cc1cccc(C)c1/N=C1\C=CC=CC1C/C=N/c1c(C)cccc1C |
| InChI | InChI=1S/C24H26N2/c1-17-9-7-10-18(2)23(17)25-16-15-21-13-5-6-14-22(21)26-24-19(3)11-8-12-20(24)4/h5-14,16,21H,15H2,1-4H3/b25-16+,26-22+ |
| InChIKey | UIWQXORREKSFOO-LKZVIGDNSA-N |
| XLogP | 6.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|