C28H38N2 — CID 126613600
2-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexan-1-imine (PubChem CID 126613600) has the molecular formula C28H38N2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 2-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexan-1-imine.
| Compound Name | 2-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexan-1-imine |
|---|---|
| PubChem CID | 126613600 |
| Molecular Formula | C28H38N2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 2-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-N-[2,6-di(propan-2-yl)phenyl]cyclohexan-1-imine |
| SMILES | C/C(=N\c1c(C)cccc1C)C1CCCC/C1=N\c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H38N2/c1-18(2)23-15-11-16-24(19(3)4)28(23)30-26-17-9-8-14-25(26)22(7)29-27-20(5)12-10-13-21(27)6/h10-13,15-16,18-19,25H,8-9,14,17H2,1-7H3/b29-22+,30-26+ |
| InChIKey | JCMWWUJKNDDBFQ-GLQUDUCRSA-N |
| XLogP | 8.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|